C50H64HfSi — CID 150174113
bis(4-(3,5-ditert-butylphenyl)-2-methyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) (PubChem CID 150174113) has the molecular formula C50H64HfSi and a molecular weight of 871.64 g/mol. Its IUPAC name is bis(4-(3,5-ditert-butylphenyl)-2-methyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+).
| Compound Name | bis(4-(3,5-ditert-butylphenyl)-2-methyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) |
|---|---|
| PubChem CID | 150174113 |
| Molecular Formula | C50H64HfSi |
| Molecular Weight | 871.64 g/mol |
| Exact Mass | 872.42 |
| IUPAC Name | bis(4-(3,5-ditert-butylphenyl)-2-methyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) |
| SMILES | C[Si](C)=[Hf+2].Cc1cc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cccc2[cH-]1.Cc1cc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cccc2[cH-]1 |
| InChI | InChI=1S/2C24H29.C2H6Si.Hf/c2*1-16-11-17-9-8-10-21(22(17)12-16)18-13-19(23(2,3)4)15-20(14-18)24(5,6)7;1-3-2;/h2*8-15H,1-7H3;1-2H3;/q2*-1;;+2 |
| InChIKey | HPIFIKQYMWFMKE-UHFFFAOYSA-N |
| XLogP | 15.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.64 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|