C18H17Li — CID 22023088
lithium 4-(3,5-dimethylphenyl)-2-methyl-1H-inden-1-ide (PubChem CID 22023088) has the molecular formula C18H17Li and a molecular weight of 240.27 g/mol. Its IUPAC name is lithium 4-(3,5-dimethylphenyl)-2-methyl-1H-inden-1-ide.
| Compound Name | lithium 4-(3,5-dimethylphenyl)-2-methyl-1H-inden-1-ide |
|---|---|
| PubChem CID | 22023088 |
| Molecular Formula | C18H17Li |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | lithium 4-(3,5-dimethylphenyl)-2-methyl-1H-inden-1-ide |
| SMILES | Cc1cc(C)cc(-c2cccc3[cH-]c(C)cc23)c1.[Li+] |
| InChI | InChI=1S/C18H17.Li/c1-12-7-13(2)10-16(9-12)17-6-4-5-15-8-14(3)11-18(15)17;/h4-11H,1-3H3;/q-1;+1 |
| InChIKey | PNULQWFHNXOKNT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|