C44H46SiZr — CID 173211848
2,7-ditert-butyl-9H-fluoren-9-ide;2-methyl-4-phenyl-1H-inden-1-ide;[methyl(phenyl)silylidene]zirconium(2+) (PubChem CID 173211848) has the molecular formula C44H46SiZr and a molecular weight of 694.16 g/mol. Its IUPAC name is 2,7-ditert-butyl-9H-fluoren-9-ide;2-methyl-4-phenyl-1H-inden-1-ide;[methyl(phenyl)silylidene]zirconium(2+).
| Compound Name | 2,7-ditert-butyl-9H-fluoren-9-ide;2-methyl-4-phenyl-1H-inden-1-ide;[methyl(phenyl)silylidene]zirconium(2+) |
|---|---|
| PubChem CID | 173211848 |
| Molecular Formula | C44H46SiZr |
| Molecular Weight | 694.16 g/mol |
| Exact Mass | 692.24 |
| IUPAC Name | 2,7-ditert-butyl-9H-fluoren-9-ide;2-methyl-4-phenyl-1H-inden-1-ide;[methyl(phenyl)silylidene]zirconium(2+) |
| SMILES | CC(C)(C)c1ccc2c(c1)[cH-]c1cc(C(C)(C)C)ccc12.C[Si](=[Zr+2])c1ccccc1.Cc1cc2c(-c3ccccc3)cccc2[cH-]1 |
| InChI | InChI=1S/C21H25.C16H13.C7H8Si.Zr/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-12-10-14-8-5-9-15(16(14)11-12)13-6-3-2-4-7-13;1-8-7-5-3-2-4-6-7;/h7-13H,1-6H3;2-11H,1H3;2-6H,1H3;/q2*-1;;+2 |
| InChIKey | MUBKLBTYMDJIGY-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.16 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|