C33H40SiZr — CID 173211702
2,7-ditert-butyl-9H-fluoren-9-ide;dimethylsilylidenezirconium(2+);2-methyl-1H-inden-1-ide (PubChem CID 173211702) has the molecular formula C33H40SiZr and a molecular weight of 555.99 g/mol. Its IUPAC name is 2,7-ditert-butyl-9H-fluoren-9-ide;dimethylsilylidenezirconium(2+);2-methyl-1H-inden-1-ide.
| Compound Name | 2,7-ditert-butyl-9H-fluoren-9-ide;dimethylsilylidenezirconium(2+);2-methyl-1H-inden-1-ide |
|---|---|
| PubChem CID | 173211702 |
| Molecular Formula | C33H40SiZr |
| Molecular Weight | 555.99 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 2,7-ditert-butyl-9H-fluoren-9-ide;dimethylsilylidenezirconium(2+);2-methyl-1H-inden-1-ide |
| SMILES | CC(C)(C)c1ccc2c(c1)[cH-]c1cc(C(C)(C)C)ccc12.C[Si](C)=[Zr+2].Cc1cc2ccccc2[cH-]1 |
| InChI | InChI=1S/C21H25.C10H9.C2H6Si.Zr/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-8-6-9-4-2-3-5-10(9)7-8;1-3-2;/h7-13H,1-6H3;2-7H,1H3;1-2H3;/q2*-1;;+2 |
| InChIKey | OLLMIQMONFZHLA-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.99 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|