C14H17Cl2Zr — CID 172812508
2,6-dimethyl-4-propyl-1H-inden-1-ide;zirconium(3+);dichloride (PubChem CID 172812508) has the molecular formula C14H17Cl2Zr and a molecular weight of 347.42 g/mol. Its IUPAC name is 2,6-dimethyl-4-propyl-1H-inden-1-ide;zirconium(3+);dichloride.
| Compound Name | 2,6-dimethyl-4-propyl-1H-inden-1-ide;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 172812508 |
| Molecular Formula | C14H17Cl2Zr |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 2,6-dimethyl-4-propyl-1H-inden-1-ide;zirconium(3+);dichloride |
| SMILES | CCCc1cc(C)cc2[cH-]c(C)cc12.[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C14H17.2ClH.Zr/c1-4-5-12-6-10(2)7-13-8-11(3)9-14(12)13;;;/h6-9H,4-5H2,1-3H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | XHCBTDCNRIQQEE-UHFFFAOYSA-L |
| XLogP | -1.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|