About 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide
7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide (PubChem CID 161230348) has the molecular formula C15H19Br2Zr
and a molecular weight of 450.35 g/mol. Its IUPAC name is 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide.
Molecular Properties
| Compound Name | 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide |
| PubChem CID | 161230348 |
| Molecular Formula | C15H19Br2Zr |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 446.89 |
| IUPAC Name | 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide |
| SMILES | CCCc1ccc(CC)c2[cH-]c(C)cc12.[Br-].[Br-].[Zr+3] |
| InChI | InChI=1S/C15H19.2BrH.Zr/c1-4-6-13-8-7-12(5-2)14-9-11(3)10-15(13)14;;;/h7-10H,4-6H2,1-3H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | BJRRRTXUUYFMSN-UHFFFAOYSA-L |
| XLogP | -1.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide?
The IUPAC name of 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide (CID 161230348) is 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide.
What is the SMILES notation for 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide?
The canonical SMILES for 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide is CCCc1ccc(CC)c2[cH-]c(C)cc12.[Br-].[Br-].[Zr+3].
What is the InChIKey of 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide?
The InChIKey is BJRRRTXUUYFMSN-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H19.2BrH.Zr/c1-4-6-13-8-7-12(5-2)14-9-11(3)10-15(13)14;;;/h7-10H,4-6H2,1-3H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide?
7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide has a molecular weight of 450.35 g/mol, XLogP of -1.61, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2-methyl-4-propyl-1H-inden-1-ide;zirconium(3+);dibromide is sourced from PubChem (CID 161230348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).