C17H23Cl2Zr- — CID 174402976
dichlorozirconium;4-hexyl-2,7-dimethyl-1H-inden-1-ide (PubChem CID 174402976) has the molecular formula C17H23Cl2Zr- and a molecular weight of 389.50 g/mol. Its IUPAC name is dichlorozirconium;4-hexyl-2,7-dimethyl-1H-inden-1-ide.
| Compound Name | dichlorozirconium;4-hexyl-2,7-dimethyl-1H-inden-1-ide |
|---|---|
| PubChem CID | 174402976 |
| Molecular Formula | C17H23Cl2Zr- |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | dichlorozirconium;4-hexyl-2,7-dimethyl-1H-inden-1-ide |
| SMILES | CCCCCCc1ccc(C)c2[cH-]c(C)cc12.Cl[Zr]Cl |
| InChI | InChI=1S/C17H23.2ClH.Zr/c1-4-5-6-7-8-15-10-9-14(3)16-11-13(2)12-17(15)16;;;/h9-12H,4-8H2,1-3H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | FYCOMKQOBWKRFR-UHFFFAOYSA-L |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|