About 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium
4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium (PubChem CID 174376953) has the molecular formula C16H25SiZr-
and a molecular weight of 336.69 g/mol. Its IUPAC name is 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium.
Molecular Properties
| Compound Name | 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium |
| PubChem CID | 174376953 |
| Molecular Formula | C16H25SiZr- |
| Molecular Weight | 336.69 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium |
| SMILES | CCc1cccc2[cH-]c(C)cc12.C[Si](C)(C)C.[Zr] |
| InChI | InChI=1S/C12H13.C4H12Si.Zr/c1-3-10-5-4-6-11-7-9(2)8-12(10)11;1-5(2,3)4;/h4-8H,3H2,1-2H3;1-4H3;/q-1;; |
| InChIKey | AZQFGFZZEKCBDJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.69 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium?
The IUPAC name of 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium (CID 174376953) is 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium.
What is the SMILES notation for 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium?
The canonical SMILES for 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium is CCc1cccc2[cH-]c(C)cc12.C[Si](C)(C)C.[Zr].
What is the InChIKey of 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium?
The InChIKey is AZQFGFZZEKCBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13.C4H12Si.Zr/c1-3-10-5-4-6-11-7-9(2)8-12(10)11;1-5(2,3)4;/h4-8H,3H2,1-2H3;1-4H3;/q-1;;.
What are the key properties of 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium?
4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium has a molecular weight of 336.69 g/mol, XLogP of 5.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methyl-1H-inden-1-ide;tetramethylsilane;zirconium is sourced from PubChem (CID 174376953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).