C13H15Cl2Zr- — CID 173263602
dichlorozirconium;2,4-diethyl-1H-inden-1-ide (PubChem CID 173263602) has the molecular formula C13H15Cl2Zr- and a molecular weight of 333.39 g/mol. Its IUPAC name is dichlorozirconium;2,4-diethyl-1H-inden-1-ide.
| Compound Name | dichlorozirconium;2,4-diethyl-1H-inden-1-ide |
|---|---|
| PubChem CID | 173263602 |
| Molecular Formula | C13H15Cl2Zr- |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | dichlorozirconium;2,4-diethyl-1H-inden-1-ide |
| SMILES | CCc1cc2c(CC)cccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C13H15.2ClH.Zr/c1-3-10-8-12-7-5-6-11(4-2)13(12)9-10;;;/h5-9H,3-4H2,1-2H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | PHKSIBWCWMHWDV-UHFFFAOYSA-L |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|