C13H15Cl2Hf-3 — CID 159398719
2,4-diethyl-1H-inden-1-ide;hafnium;dichloride (PubChem CID 159398719) has the molecular formula C13H15Cl2Hf-3 and a molecular weight of 420.66 g/mol. Its IUPAC name is 2,4-diethyl-1H-inden-1-ide;hafnium;dichloride.
| Compound Name | 2,4-diethyl-1H-inden-1-ide;hafnium;dichloride |
|---|---|
| PubChem CID | 159398719 |
| Molecular Formula | C13H15Cl2Hf-3 |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | 2,4-diethyl-1H-inden-1-ide;hafnium;dichloride |
| SMILES | CCc1cc2c(CC)cccc2[cH-]1.[Cl-].[Cl-].[Hf] |
| InChI | InChI=1S/C13H15.2ClH.Hf/c1-3-10-8-12-7-5-6-11(4-2)13(12)9-10;;;/h5-9H,3-4H2,1-2H3;2*1H;/q-1;;;/p-2 |
| InChIKey | GZHSAMABCNXIAF-UHFFFAOYSA-L |
| XLogP | -2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|