C21H17Cl2F6Zr- — CID 87884053
4-[3,5-bis(trifluoromethyl)phenyl]-2,5-diethyl-1H-inden-1-ide;dichlorozirconium (PubChem CID 87884053) has the molecular formula C21H17Cl2F6Zr- and a molecular weight of 545.49 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-2,5-diethyl-1H-inden-1-ide;dichlorozirconium.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2,5-diethyl-1H-inden-1-ide;dichlorozirconium |
|---|---|
| PubChem CID | 87884053 |
| Molecular Formula | C21H17Cl2F6Zr- |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 542.97 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2,5-diethyl-1H-inden-1-ide;dichlorozirconium |
| SMILES | CCc1cc2c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(CC)ccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C21H17F6.2ClH.Zr/c1-3-12-7-14-6-5-13(4-2)19(18(14)8-12)15-9-16(20(22,23)24)11-17(10-15)21(25,26)27;;;/h5-11H,3-4H2,1-2H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | JPQAFHQODGTETP-UHFFFAOYSA-L |
| XLogP | 8.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|