C29H39Cl2Zr- — CID 87884178
2-butyl-4-(3,5-ditert-butylphenyl)-5-ethyl-1H-inden-1-ide;dichlorozirconium (PubChem CID 87884178) has the molecular formula C29H39Cl2Zr- and a molecular weight of 549.76 g/mol. Its IUPAC name is 2-butyl-4-(3,5-ditert-butylphenyl)-5-ethyl-1H-inden-1-ide;dichlorozirconium.
| Compound Name | 2-butyl-4-(3,5-ditert-butylphenyl)-5-ethyl-1H-inden-1-ide;dichlorozirconium |
|---|---|
| PubChem CID | 87884178 |
| Molecular Formula | C29H39Cl2Zr- |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 2-butyl-4-(3,5-ditert-butylphenyl)-5-ethyl-1H-inden-1-ide;dichlorozirconium |
| SMILES | CCCCc1cc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c(CC)ccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C29H39.2ClH.Zr/c1-9-11-12-20-15-22-14-13-21(10-2)27(26(22)16-20)23-17-24(28(3,4)5)19-25(18-23)29(6,7)8;;;/h13-19H,9-12H2,1-8H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | QPKKABWXIIHCCP-UHFFFAOYSA-L |
| XLogP | 10.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|