About 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium
4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium (PubChem CID 87884094) has the molecular formula C21H17Cl2F6Zr-
and a molecular weight of 545.49 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium.
Molecular Properties
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium |
| PubChem CID | 87884094 |
| Molecular Formula | C21H17Cl2F6Zr- |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 542.97 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium |
| SMILES | CCCc1cc2c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(C)ccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C21H17F6.2ClH.Zr/c1-3-4-13-7-14-6-5-12(2)19(18(14)8-13)15-9-16(20(22,23)24)11-17(10-15)21(25,26)27;;;/h5-11H,3-4H2,1-2H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | JVMFYLNHYPXZIC-UHFFFAOYSA-L |
| XLogP | 8.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium?
The IUPAC name of 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium (CID 87884094) is 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium.
What is the SMILES notation for 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium?
The canonical SMILES for 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium is CCCc1cc2c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(C)ccc2[cH-]1.Cl[Zr]Cl.
What is the InChIKey of 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium?
The InChIKey is JVMFYLNHYPXZIC-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H17F6.2ClH.Zr/c1-3-4-13-7-14-6-5-12(2)19(18(14)8-13)15-9-16(20(22,23)24)11-17(10-15)21(25,26)27;;;/h5-11H,3-4H2,1-2H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium?
4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium has a molecular weight of 545.49 g/mol, XLogP of 8.90, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-bis(trifluoromethyl)phenyl]-5-methyl-2-propyl-1H-inden-1-ide;dichlorozirconium is sourced from PubChem (CID 87884094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).