C40H38Cl2F6GeZr-2 — CID 173304835
dichloro(dimethylgermylidene)zirconium;bis(2-propyl-4-[4-(trifluoromethyl)phenyl]-1H-inden-1-ide) (PubChem CID 173304835) has the molecular formula C40H38Cl2F6GeZr-2 and a molecular weight of 867.47 g/mol. Its IUPAC name is dichloro(dimethylgermylidene)zirconium;bis(2-propyl-4-[4-(trifluoromethyl)phenyl]-1H-inden-1-ide).
| Compound Name | dichloro(dimethylgermylidene)zirconium;bis(2-propyl-4-[4-(trifluoromethyl)phenyl]-1H-inden-1-ide) |
|---|---|
| PubChem CID | 173304835 |
| Molecular Formula | C40H38Cl2F6GeZr-2 |
| Molecular Weight | 867.47 g/mol |
| Exact Mass | 866.05 |
| IUPAC Name | dichloro(dimethylgermylidene)zirconium;bis(2-propyl-4-[4-(trifluoromethyl)phenyl]-1H-inden-1-ide) |
| SMILES | CCCc1cc2c(-c3ccc(C(F)(F)F)cc3)cccc2[cH-]1.CCCc1cc2c(-c3ccc(C(F)(F)F)cc3)cccc2[cH-]1.C[Ge](C)=[Zr](Cl)Cl |
| InChI | InChI=1S/2C19H16F3.C2H6Ge.2ClH.Zr/c2*1-2-4-13-11-15-5-3-6-17(18(15)12-13)14-7-9-16(10-8-14)19(20,21)22;1-3-2;;;/h2*3,5-12H,2,4H2,1H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | PKMOBOONKFWSHZ-UHFFFAOYSA-L |
| XLogP | 14.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.47 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|