C42H30Cl2F18SiZr-2 — CID 154443014
dichloro(dimethylsilylidene)zirconium;bis(2-ethyl-4-[2,4,6-tris(trifluoromethyl)phenyl]-1H-inden-1-ide) (PubChem CID 154443014) has the molecular formula C42H30Cl2F18SiZr-2 and a molecular weight of 1066.88 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(2-ethyl-4-[2,4,6-tris(trifluoromethyl)phenyl]-1H-inden-1-ide).
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(2-ethyl-4-[2,4,6-tris(trifluoromethyl)phenyl]-1H-inden-1-ide) |
|---|---|
| PubChem CID | 154443014 |
| Molecular Formula | C42H30Cl2F18SiZr-2 |
| Molecular Weight | 1066.88 g/mol |
| Exact Mass | 1064.03 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(2-ethyl-4-[2,4,6-tris(trifluoromethyl)phenyl]-1H-inden-1-ide) |
| SMILES | CCc1cc2c(-c3c(C(F)(F)F)cc(C(F)(F)F)cc3C(F)(F)F)cccc2[cH-]1.CCc1cc2c(-c3c(C(F)(F)F)cc(C(F)(F)F)cc3C(F)(F)F)cccc2[cH-]1.C[Si](C)=[Zr](Cl)Cl |
| InChI | InChI=1S/2C20H12F9.C2H6Si.2ClH.Zr/c2*1-2-10-6-11-4-3-5-13(14(11)7-10)17-15(19(24,25)26)8-12(18(21,22)23)9-16(17)20(27,28)29;1-3-2;;;/h2*3-9H,2H2,1H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | HTWCMSHBJKZSDY-UHFFFAOYSA-L |
| XLogP | 17.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.88 |
| LogP ≤ 5 | 17.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|