C23H27Cl2Zr- — CID 87884251
dichlorozirconium;4-(3,5-dimethylphenyl)-2,5-dipropyl-1H-inden-1-ide (PubChem CID 87884251) has the molecular formula C23H27Cl2Zr- and a molecular weight of 465.60 g/mol. Its IUPAC name is dichlorozirconium;4-(3,5-dimethylphenyl)-2,5-dipropyl-1H-inden-1-ide.
| Compound Name | dichlorozirconium;4-(3,5-dimethylphenyl)-2,5-dipropyl-1H-inden-1-ide |
|---|---|
| PubChem CID | 87884251 |
| Molecular Formula | C23H27Cl2Zr- |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | dichlorozirconium;4-(3,5-dimethylphenyl)-2,5-dipropyl-1H-inden-1-ide |
| SMILES | CCCc1cc2c(-c3cc(C)cc(C)c3)c(CCC)ccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C23H27.2ClH.Zr/c1-5-7-18-14-20-10-9-19(8-6-2)23(22(20)15-18)21-12-16(3)11-17(4)13-21;;;/h9-15H,5-8H2,1-4H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | ARFYPSSHHDFYLN-UHFFFAOYSA-L |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|