About dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide
dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide (PubChem CID 87884069) has the molecular formula C23H27Cl2Zr-
and a molecular weight of 465.60 g/mol. Its IUPAC name is dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide.
Molecular Properties
| Compound Name | dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide |
| PubChem CID | 87884069 |
| Molecular Formula | C23H27Cl2Zr- |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide |
| SMILES | CCCc1cc2c(-c3ccccc3C(C)C)c(CC)ccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C23H27.2ClH.Zr/c1-5-9-17-14-19-13-12-18(6-2)23(22(19)15-17)21-11-8-7-10-20(21)16(3)4;;;/h7-8,10-16H,5-6,9H2,1-4H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | QQDWGJAWFOJSGN-UHFFFAOYSA-L |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide?
The IUPAC name of dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide (CID 87884069) is dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide.
What is the SMILES notation for dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide?
The canonical SMILES for dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide is CCCc1cc2c(-c3ccccc3C(C)C)c(CC)ccc2[cH-]1.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide?
The InChIKey is QQDWGJAWFOJSGN-UHFFFAOYSA-L. The full InChI is InChI=1S/C23H27.2ClH.Zr/c1-5-9-17-14-19-13-12-18(6-2)23(22(19)15-17)21-11-8-7-10-20(21)16(3)4;;;/h7-8,10-16H,5-6,9H2,1-4H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide?
dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide has a molecular weight of 465.60 g/mol, XLogP of 8.24, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;5-ethyl-4-(2-propan-2-ylphenyl)-2-propyl-1H-inden-1-ide is sourced from PubChem (CID 87884069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).