About 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium
2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium (PubChem CID 87884167) has the molecular formula C24H29Cl2Zr-
and a molecular weight of 479.63 g/mol. Its IUPAC name is 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium.
Molecular Properties
| Compound Name | 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium |
| PubChem CID | 87884167 |
| Molecular Formula | C24H29Cl2Zr- |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium |
| SMILES | CCc1ccc2[cH-]c(C(C)CC)cc2c1-c1ccccc1C(C)C.Cl[Zr]Cl |
| InChI | InChI=1S/C24H29.2ClH.Zr/c1-6-17(5)20-14-19-13-12-18(7-2)24(23(19)15-20)22-11-9-8-10-21(22)16(3)4;;;/h8-17H,6-7H2,1-5H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | QJYHZEMHFNNCTF-UHFFFAOYSA-L |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium?
The IUPAC name of 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium (CID 87884167) is 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium.
What is the SMILES notation for 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium?
The canonical SMILES for 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium is CCc1ccc2[cH-]c(C(C)CC)cc2c1-c1ccccc1C(C)C.Cl[Zr]Cl.
What is the InChIKey of 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium?
The InChIKey is QJYHZEMHFNNCTF-UHFFFAOYSA-L. The full InChI is InChI=1S/C24H29.2ClH.Zr/c1-6-17(5)20-14-19-13-12-18(7-2)24(23(19)15-20)22-11-9-8-10-21(22)16(3)4;;;/h8-17H,6-7H2,1-5H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium?
2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium has a molecular weight of 479.63 g/mol, XLogP of 8.80, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-5-ethyl-4-(2-propan-2-ylphenyl)-1H-inden-1-ide;dichlorozirconium is sourced from PubChem (CID 87884167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).