C19H19Cl2Zr — CID 173229855
4-(3,5-dimethylphenyl)-2,5-dimethyl-1H-inden-1-ide;zirconium(3+);dichloride (PubChem CID 173229855) has the molecular formula C19H19Cl2Zr and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-2,5-dimethyl-1H-inden-1-ide;zirconium(3+);dichloride.
| Compound Name | 4-(3,5-dimethylphenyl)-2,5-dimethyl-1H-inden-1-ide;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 173229855 |
| Molecular Formula | C19H19Cl2Zr |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-2,5-dimethyl-1H-inden-1-ide;zirconium(3+);dichloride |
| SMILES | Cc1cc(C)cc(-c2c(C)ccc3[cH-]c(C)cc23)c1.[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C19H19.2ClH.Zr/c1-12-7-13(2)10-17(9-12)19-15(4)5-6-16-8-14(3)11-18(16)19;;;/h5-11H,1-4H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | ONNLRLKQWYGPGU-UHFFFAOYSA-L |
| XLogP | -0.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|