C25H30N2O4 — CID 172729096
5-amino-7-benzoyl-4-hydroxy-1-methyl-3-octoxyquinolin-2-one (PubChem CID 172729096) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-amino-7-benzoyl-4-hydroxy-1-methyl-3-octoxyquinolin-2-one.
| Compound Name | 5-amino-7-benzoyl-4-hydroxy-1-methyl-3-octoxyquinolin-2-one |
|---|---|
| PubChem CID | 172729096 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5-amino-7-benzoyl-4-hydroxy-1-methyl-3-octoxyquinolin-2-one |
| SMILES | CCCCCCCCOc1c(O)c2c(N)cc(C(=O)c3ccccc3)cc2n(C)c1=O |
| InChI | InChI=1S/C25H30N2O4/c1-3-4-5-6-7-11-14-31-24-23(29)21-19(26)15-18(16-20(21)27(2)25(24)30)22(28)17-12-9-8-10-13-17/h8-10,12-13,15-16,29H,3-7,11,14,26H2,1-2H3 |
| InChIKey | HNZNTRUFAFWRNJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|