C28H17Cl2N5O4S — CID 17273042
(2Z)-5-amino-7-(2-chlorophenyl)-2-[(2-chlorophenyl)methylidene]-6-cyano-N-(3-nitrophenyl)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxamide (PubChem CID 17273042) has the molecular formula C28H17Cl2N5O4S and a molecular weight of 590.45 g/mol. Its IUPAC name is (2Z)-5-amino-7-(2-chlorophenyl)-2-[(2-chlorophenyl)methylidene]-6-cyano-N-(3-nitrophenyl)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxamide.
| Compound Name | (2Z)-5-amino-7-(2-chlorophenyl)-2-[(2-chlorophenyl)methylidene]-6-cyano-N-(3-nitrophenyl)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 17273042 |
| Molecular Formula | C28H17Cl2N5O4S |
| Molecular Weight | 590.45 g/mol |
| Exact Mass | 589.04 |
| IUPAC Name | (2Z)-5-amino-7-(2-chlorophenyl)-2-[(2-chlorophenyl)methylidene]-6-cyano-N-(3-nitrophenyl)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxamide |
| SMILES | N#CC1=C(N)n2c(s/c(=C\c3ccccc3Cl)c2=O)=C(C(=O)Nc2cccc([N+](=O)[O-])c2)C1c1ccccc1Cl |
| InChI | InChI=1S/C28H17Cl2N5O4S/c29-20-10-3-1-6-15(20)12-22-27(37)34-25(32)19(14-31)23(18-9-2-4-11-21(18)30)24(28(34)40-22)26(36)33-16-7-5-8-17(13-16)35(38)39/h1-13,23H,32H2,(H,33,36)/b22-12- |
| InChIKey | GFICMJCBPHPGGR-UUYOSTAYSA-N |
| XLogP | 4.19 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|