C28H17N7O8S — CID 17273050
(2Z)-5-amino-6-cyano-N-(3-nitrophenyl)-7-(4-nitrophenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxamide (PubChem CID 17273050) has the molecular formula C28H17N7O8S and a molecular weight of 611.55 g/mol. Its IUPAC name is (2Z)-5-amino-6-cyano-N-(3-nitrophenyl)-7-(4-nitrophenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxamide.
| Compound Name | (2Z)-5-amino-6-cyano-N-(3-nitrophenyl)-7-(4-nitrophenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 17273050 |
| Molecular Formula | C28H17N7O8S |
| Molecular Weight | 611.55 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | (2Z)-5-amino-6-cyano-N-(3-nitrophenyl)-7-(4-nitrophenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-8-carboxamide |
| SMILES | N#CC1=C(N)n2c(s/c(=C\c3ccc([N+](=O)[O-])cc3)c2=O)=C(C(=O)Nc2cccc([N+](=O)[O-])c2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H17N7O8S/c29-14-21-23(16-6-10-19(11-7-16)34(40)41)24(26(36)31-17-2-1-3-20(13-17)35(42)43)28-32(25(21)30)27(37)22(44-28)12-15-4-8-18(9-5-15)33(38)39/h1-13,23H,30H2,(H,31,36)/b22-12- |
| InChIKey | UEICFHFFQPOMBO-UUYOSTAYSA-N |
| XLogP | 2.70 |
| TPSA | 230.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|