About 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene
7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene (PubChem CID 172730871) has the molecular formula C10H7NS
and a molecular weight of 173.24 g/mol. Its IUPAC name is 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene.
Analyze 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene?
The IUPAC name of 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene (CID 172730871) is 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene.
What is the SMILES notation for 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene?
The canonical SMILES for 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene is C1=Cc2c3c(sc2=C1)=CN=CC3.
What is the InChIKey of 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene?
The InChIKey is HTTRGZVBLBLXAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NS/c1-2-7-8-4-5-11-6-10(8)12-9(7)3-1/h1-3,5-6H,4H2.
What are the key properties of 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene?
7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene has a molecular weight of 173.24 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1,3,5,8,10-pentaene is sourced from PubChem (CID 172730871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).