C9H6N2S — CID 90707975
1λ4-thia-4,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 90707975) has the molecular formula C9H6N2S and a molecular weight of 174.23 g/mol. Its IUPAC name is 1λ4-thia-4,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | 1λ4-thia-4,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 90707975 |
| Molecular Formula | C9H6N2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 1λ4-thia-4,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,6,8,10-hexaene |
| SMILES | C1=NC=S2C(=C1)C=C1C=NC=C12 |
| InChI | InChI=1S/C9H6N2S/c1-2-10-6-12-8(1)3-7-4-11-5-9(7)12/h1-6H |
| InChIKey | KIJDGRBYYZHNMW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|