C29H33N7O4S — CID 172736273
(2S)-3,3-dimethyl-2-[4-[4-[[5-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]piperazin-1-yl]-4-oxobutanamide (PubChem CID 172736273) has the molecular formula C29H33N7O4S and a molecular weight of 575.70 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[4-[4-[[5-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]piperazin-1-yl]-4-oxobutanamide.
| Compound Name | (2S)-3,3-dimethyl-2-[4-[4-[[5-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]piperazin-1-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 172736273 |
| Molecular Formula | C29H33N7O4S |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[4-[4-[[5-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]piperazin-1-yl]-4-oxobutanamide |
| SMILES | CC(C)(C=O)[C@@H](C(N)=O)N1CCN(c2ccc(Nc3nc4cccc(-c5ccc(S(C)(=O)=O)cc5)n4n3)cc2)CC1 |
| InChI | InChI=1S/C29H33N7O4S/c1-29(2,19-37)26(27(30)38)35-17-15-34(16-18-35)22-11-9-21(10-12-22)31-28-32-25-6-4-5-24(36(25)33-28)20-7-13-23(14-8-20)41(3,39)40/h4-14,19,26H,15-18H2,1-3H3,(H2,30,38)(H,31,33)/t26-/m1/s1 |
| InChIKey | IMEYSOJEPOYAQM-AREMUKBSSA-N |
| XLogP | 2.74 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|