C27H31N7O2S — CID 178066207
N-[3-(4-methylpiperazin-1-yl)-5-methylsulfonylphenyl]-5-(1,2,3,4-tetrahydroisoquinolin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 178066207) has the molecular formula C27H31N7O2S and a molecular weight of 517.66 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)-5-methylsulfonylphenyl]-5-(1,2,3,4-tetrahydroisoquinolin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)-5-methylsulfonylphenyl]-5-(1,2,3,4-tetrahydroisoquinolin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 178066207 |
| Molecular Formula | C27H31N7O2S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)-5-methylsulfonylphenyl]-5-(1,2,3,4-tetrahydroisoquinolin-6-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CN1CCN(c2cc(Nc3nc4cccc(-c5ccc6c(c5)CCNC6)n4n3)cc(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C27H31N7O2S/c1-32-10-12-33(13-11-32)23-15-22(16-24(17-23)37(2,35)36)29-27-30-26-5-3-4-25(34(26)31-27)20-6-7-21-18-28-9-8-19(21)14-20/h3-7,14-17,28H,8-13,18H2,1-2H3,(H,29,31) |
| InChIKey | QBJRJGXOPBGYPL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |