C25H27N7O — CID 91526892
1-[5-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 91526892) has the molecular formula C25H27N7O and a molecular weight of 441.54 g/mol. Its IUPAC name is 1-[5-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-[5-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 91526892 |
| Molecular Formula | C25H27N7O |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-[5-(3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | Cc1cccc(-c2cccc3nc(NC(=O)Nc4ccc(N5CCN(C)CC5)cc4)nn23)c1 |
| InChI | InChI=1S/C25H27N7O/c1-18-5-3-6-19(17-18)22-7-4-8-23-27-24(29-32(22)23)28-25(33)26-20-9-11-21(12-10-20)31-15-13-30(2)14-16-31/h3-12,17H,13-16H2,1-2H3,(H2,26,28,29,33) |
| InChIKey | DHBQDRFGXDCSJV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|