C25H26F3N3O2 — CID 172736574
3-[[4-(1-cyclobutylpiperidin-2-yl)oxyphenyl]methyl]-2-(trifluoromethyl)quinazolin-4-one (PubChem CID 172736574) has the molecular formula C25H26F3N3O2 and a molecular weight of 457.50 g/mol. Its IUPAC name is 3-[[4-(1-cyclobutylpiperidin-2-yl)oxyphenyl]methyl]-2-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 3-[[4-(1-cyclobutylpiperidin-2-yl)oxyphenyl]methyl]-2-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 172736574 |
| Molecular Formula | C25H26F3N3O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 3-[[4-(1-cyclobutylpiperidin-2-yl)oxyphenyl]methyl]-2-(trifluoromethyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C(F)(F)F)n1Cc1ccc(OC2CCCCN2C2CCC2)cc1 |
| InChI | InChI=1S/C25H26F3N3O2/c26-25(27,28)24-29-21-9-2-1-8-20(21)23(32)31(24)16-17-11-13-19(14-12-17)33-22-10-3-4-15-30(22)18-6-5-7-18/h1-2,8-9,11-14,18,22H,3-7,10,15-16H2 |
| InChIKey | INFPPBJMWSNFBR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |