C14H12F3N3O — CID 23247551
3-(2-prop-2-enylaziridin-1-yl)-2-(trifluoromethyl)quinazolin-4-one (PubChem CID 23247551) has the molecular formula C14H12F3N3O and a molecular weight of 295.26 g/mol. Its IUPAC name is 3-(2-prop-2-enylaziridin-1-yl)-2-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 3-(2-prop-2-enylaziridin-1-yl)-2-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 23247551 |
| Molecular Formula | C14H12F3N3O |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-(2-prop-2-enylaziridin-1-yl)-2-(trifluoromethyl)quinazolin-4-one |
| SMILES | C=CCC1CN1n1c(C(F)(F)F)nc2ccccc2c1=O |
| InChI | InChI=1S/C14H12F3N3O/c1-2-5-9-8-19(9)20-12(21)10-6-3-4-7-11(10)18-13(20)14(15,16)17/h2-4,6-7,9H,1,5,8H2 |
| InChIKey | BKUNYEAUZDFAEH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|