C13H10F3N3O3 — CID 10686625
methyl 1-[4-oxo-2-(trifluoromethyl)quinazolin-3-yl]aziridine-2-carboxylate (PubChem CID 10686625) has the molecular formula C13H10F3N3O3 and a molecular weight of 313.24 g/mol. Its IUPAC name is methyl 1-[4-oxo-2-(trifluoromethyl)quinazolin-3-yl]aziridine-2-carboxylate.
| Compound Name | methyl 1-[4-oxo-2-(trifluoromethyl)quinazolin-3-yl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 10686625 |
| Molecular Formula | C13H10F3N3O3 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | methyl 1-[4-oxo-2-(trifluoromethyl)quinazolin-3-yl]aziridine-2-carboxylate |
| SMILES | COC(=O)C1CN1n1c(C(F)(F)F)nc2ccccc2c1=O |
| InChI | InChI=1S/C13H10F3N3O3/c1-22-11(21)9-6-18(9)19-10(20)7-4-2-3-5-8(7)17-12(19)13(14,15)16/h2-5,9H,6H2,1H3 |
| InChIKey | AOJBXHXVCVBWSI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|