About 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one
3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one (PubChem CID 101169326) has the molecular formula C23H16F3N3O
and a molecular weight of 407.40 g/mol. Its IUPAC name is 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one.
Molecular Properties
| Compound Name | 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one |
| PubChem CID | 101169326 |
| Molecular Formula | C23H16F3N3O |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C(F)(F)F)n1NC1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C23H16F3N3O/c24-23(25,26)22-27-19-12-6-5-11-18(19)21(30)29(22)28-20-16-9-3-1-7-14(16)13-15-8-2-4-10-17(15)20/h1-12,20,28H,13H2 |
| InChIKey | ZNUJOQRALGPICF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one?
The IUPAC name of 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one (CID 101169326) is 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one.
What is the SMILES notation for 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one?
The canonical SMILES for 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one is O=c1c2ccccc2nc(C(F)(F)F)n1NC1c2ccccc2Cc2ccccc21.
What is the InChIKey of 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one?
The InChIKey is ZNUJOQRALGPICF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16F3N3O/c24-23(25,26)22-27-19-12-6-5-11-18(19)21(30)29(22)28-20-16-9-3-1-7-14(16)13-15-8-2-4-10-17(15)20/h1-12,20,28H,13H2.
What are the key properties of 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one?
3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one has a molecular weight of 407.40 g/mol, XLogP of 4.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9,10-dihydroanthracen-9-ylamino)-2-(trifluoromethyl)quinazolin-4-one is sourced from PubChem (CID 101169326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).