C15H12F3N3O — CID 23247545
3-(cyclohexa-2,5-dien-1-ylamino)-2-(trifluoromethyl)quinazolin-4-one (PubChem CID 23247545) has the molecular formula C15H12F3N3O and a molecular weight of 307.28 g/mol. Its IUPAC name is 3-(cyclohexa-2,5-dien-1-ylamino)-2-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 3-(cyclohexa-2,5-dien-1-ylamino)-2-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 23247545 |
| Molecular Formula | C15H12F3N3O |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-(cyclohexa-2,5-dien-1-ylamino)-2-(trifluoromethyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C(F)(F)F)n1NC1C=CCC=C1 |
| InChI | InChI=1S/C15H12F3N3O/c16-15(17,18)14-19-12-9-5-4-8-11(12)13(22)21(14)20-10-6-2-1-3-7-10/h2-10,20H,1H2 |
| InChIKey | FZEQBPDPNMJUMO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|