C16H16F3N3O3 — CID 10713178
tert-butyl 1-[4-oxo-2-(trifluoromethyl)quinazolin-3-yl]aziridine-2-carboxylate (PubChem CID 10713178) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is tert-butyl 1-[4-oxo-2-(trifluoromethyl)quinazolin-3-yl]aziridine-2-carboxylate.
| Compound Name | tert-butyl 1-[4-oxo-2-(trifluoromethyl)quinazolin-3-yl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 10713178 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | tert-butyl 1-[4-oxo-2-(trifluoromethyl)quinazolin-3-yl]aziridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CN1n1c(C(F)(F)F)nc2ccccc2c1=O |
| InChI | InChI=1S/C16H16F3N3O3/c1-15(2,3)25-13(24)11-8-21(11)22-12(23)9-6-4-5-7-10(9)20-14(22)16(17,18)19/h4-7,11H,8H2,1-3H3 |
| InChIKey | QJYPWQUPGXMXNZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|