C16H12Br2N2O2 — CID 17274047
N-(4-amino-3,5-dibromo-2-methylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 17274047) has the molecular formula C16H12Br2N2O2 and a molecular weight of 424.09 g/mol. Its IUPAC name is N-(4-amino-3,5-dibromo-2-methylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-amino-3,5-dibromo-2-methylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17274047 |
| Molecular Formula | C16H12Br2N2O2 |
| Molecular Weight | 424.09 g/mol |
| Exact Mass | 421.93 |
| IUPAC Name | N-(4-amino-3,5-dibromo-2-methylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2cc3ccccc3o2)cc(Br)c(N)c1Br |
| InChI | InChI=1S/C16H12Br2N2O2/c1-8-11(7-10(17)15(19)14(8)18)20-16(21)13-6-9-4-2-3-5-12(9)22-13/h2-7H,19H2,1H3,(H,20,21) |
| InChIKey | DZYNAZAQICFBQD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.09 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|