C47H92O5 — CID 172740616
9-hydroxy-2,16-di(pentadecan-8-yl)heptadecanedioic acid (PubChem CID 172740616) has the molecular formula C47H92O5 and a molecular weight of 737.25 g/mol. Its IUPAC name is 9-hydroxy-2,16-di(pentadecan-8-yl)heptadecanedioic acid.
| Compound Name | 9-hydroxy-2,16-di(pentadecan-8-yl)heptadecanedioic acid |
|---|---|
| PubChem CID | 172740616 |
| Molecular Formula | C47H92O5 |
| Molecular Weight | 737.25 g/mol |
| Exact Mass | 736.69 |
| IUPAC Name | 9-hydroxy-2,16-di(pentadecan-8-yl)heptadecanedioic acid |
| SMILES | CCCCCCCC(CCCCCCC)C(CCCCCCC(O)CCCCCCC(C(=O)O)C(CCCCCCC)CCCCCCC)C(=O)O |
| InChI | InChI=1S/C47H92O5/c1-5-9-13-17-25-33-41(34-26-18-14-10-6-2)44(46(49)50)39-31-23-21-29-37-43(48)38-30-22-24-32-40-45(47(51)52)42(35-27-19-15-11-7-3)36-28-20-16-12-8-4/h41-45,48H,5-40H2,1-4H3,(H,49,50)(H,51,52) |
| InChIKey | JAUWHSUSYWKABV-UHFFFAOYSA-N |
| XLogP | 15.10 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.25 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|