C57H110O9 — CID 139559536
4-(1-carboxy-11-hydroxyheptadecyl)-2,6-bis(10-hydroxyhexadecyl)heptanedioic acid (PubChem CID 139559536) has the molecular formula C57H110O9 and a molecular weight of 939.50 g/mol. Its IUPAC name is 4-(1-carboxy-11-hydroxyheptadecyl)-2,6-bis(10-hydroxyhexadecyl)heptanedioic acid.
| Compound Name | 4-(1-carboxy-11-hydroxyheptadecyl)-2,6-bis(10-hydroxyhexadecyl)heptanedioic acid |
|---|---|
| PubChem CID | 139559536 |
| Molecular Formula | C57H110O9 |
| Molecular Weight | 939.50 g/mol |
| Exact Mass | 938.81 |
| IUPAC Name | 4-(1-carboxy-11-hydroxyheptadecyl)-2,6-bis(10-hydroxyhexadecyl)heptanedioic acid |
| SMILES | CCCCCCC(O)CCCCCCCCCC(CC(CC(CCCCCCCCCC(O)CCCCCC)C(=O)O)C(CCCCCCCCCC(O)CCCCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C57H110O9/c1-4-7-10-30-39-51(58)42-33-24-18-13-16-22-28-37-48(55(61)62)46-50(54(57(65)66)45-36-27-21-15-20-26-35-44-53(60)41-32-12-9-6-3)47-49(56(63)64)38-29-23-17-14-19-25-34-43-52(59)40-31-11-8-5-2/h48-54,58-60H,4-47H2,1-3H3,(H,61,62)(H,63,64)(H,65,66) |
| InChIKey | CCHMZTCVVVDOLJ-UHFFFAOYSA-N |
| XLogP | 16.01 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.50 |
| LogP ≤ 5 | 16.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|