C40H78O6 — CID 175957333
2,6-bis(10-hydroxyhexadecyl)-3-methylheptanedioic acid (PubChem CID 175957333) has the molecular formula C40H78O6 and a molecular weight of 655.06 g/mol. Its IUPAC name is 2,6-bis(10-hydroxyhexadecyl)-3-methylheptanedioic acid.
| Compound Name | 2,6-bis(10-hydroxyhexadecyl)-3-methylheptanedioic acid |
|---|---|
| PubChem CID | 175957333 |
| Molecular Formula | C40H78O6 |
| Molecular Weight | 655.06 g/mol |
| Exact Mass | 654.58 |
| IUPAC Name | 2,6-bis(10-hydroxyhexadecyl)-3-methylheptanedioic acid |
| SMILES | CCCCCCC(O)CCCCCCCCCC(CCC(C)C(CCCCCCCCCC(O)CCCCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C40H78O6/c1-4-6-8-21-27-36(41)29-23-17-13-10-12-16-20-26-35(39(43)44)33-32-34(3)38(40(45)46)31-25-19-15-11-14-18-24-30-37(42)28-22-9-7-5-2/h34-38,41-42H,4-33H2,1-3H3,(H,43,44)(H,45,46) |
| InChIKey | KMGAEZYPNWOJQL-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.06 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|