C19H12BF5N2O3 — CID 172740864
(2,3,4,5,6-pentafluorophenoxy)-phenylmethoxyborinic acid;pyridine-2-carbonitrile (PubChem CID 172740864) has the molecular formula C19H12BF5N2O3 and a molecular weight of 422.12 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenoxy)-phenylmethoxyborinic acid;pyridine-2-carbonitrile.
| Compound Name | (2,3,4,5,6-pentafluorophenoxy)-phenylmethoxyborinic acid;pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 172740864 |
| Molecular Formula | C19H12BF5N2O3 |
| Molecular Weight | 422.12 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenoxy)-phenylmethoxyborinic acid;pyridine-2-carbonitrile |
| SMILES | N#Cc1ccccn1.OB(OCc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H8BF5O3.C6H4N2/c15-8-9(16)11(18)13(12(19)10(8)17)22-14(20)21-6-7-4-2-1-3-5-7;7-5-6-3-1-2-4-8-6/h1-5,20H,6H2;1-4H |
| InChIKey | JBSXXJQRRNSDDH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.12 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|