C11H14N4O2 — CID 172742275
2-(3-methyl-5-oxopiperazin-1-yl)pyridine-3-carboxamide (PubChem CID 172742275) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-(3-methyl-5-oxopiperazin-1-yl)pyridine-3-carboxamide.
| Compound Name | 2-(3-methyl-5-oxopiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172742275 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-(3-methyl-5-oxopiperazin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CN(c2ncccc2C(N)=O)CC(=O)N1 |
| InChI | InChI=1S/C11H14N4O2/c1-7-5-15(6-9(16)14-7)11-8(10(12)17)3-2-4-13-11/h2-4,7H,5-6H2,1H3,(H2,12,17)(H,14,16) |
| InChIKey | JGKRHGQNBZFFIY-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |