C11H15BO5 — CID 172742581
(3-methoxy-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-en-9-yl)boronic acid (PubChem CID 172742581) has the molecular formula C11H15BO5 and a molecular weight of 238.05 g/mol. Its IUPAC name is (3-methoxy-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-en-9-yl)boronic acid.
| Compound Name | (3-methoxy-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-en-9-yl)boronic acid |
|---|---|
| PubChem CID | 172742581 |
| Molecular Formula | C11H15BO5 |
| Molecular Weight | 238.05 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (3-methoxy-2-oxo-4-oxatricyclo[5.3.1.03,8]undec-9-en-9-yl)boronic acid |
| SMILES | COC12OCCC3CC(C=C(B(O)O)C31)C2=O |
| InChI | InChI=1S/C11H15BO5/c1-16-11-9-6(2-3-17-11)4-7(10(11)13)5-8(9)12(14)15/h5-7,9,14-15H,2-4H2,1H3 |
| InChIKey | JHIWFSPDSSSJBA-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.05 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|