C10H13BO5 — CID 172767799
(3-methoxy-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl)boronic acid (PubChem CID 172767799) has the molecular formula C10H13BO5 and a molecular weight of 224.02 g/mol. Its IUPAC name is (3-methoxy-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl)boronic acid.
| Compound Name | (3-methoxy-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl)boronic acid |
|---|---|
| PubChem CID | 172767799 |
| Molecular Formula | C10H13BO5 |
| Molecular Weight | 224.02 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (3-methoxy-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-8-yl)boronic acid |
| SMILES | COC12OCC3CC(C=C(B(O)O)C31)C2=O |
| InChI | InChI=1S/C10H13BO5/c1-15-10-8-6(4-16-10)2-5(9(10)12)3-7(8)11(13)14/h3,5-6,8,13-14H,2,4H2,1H3 |
| InChIKey | MNWKNZKNBGFKAA-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.02 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|