C18H21I3N2O5 — CID 172743154
3-[[acetyl(butanoyl)amino]methyl]-5-(butanoylamino)-2,4,6-triiodobenzoic acid (PubChem CID 172743154) has the molecular formula C18H21I3N2O5 and a molecular weight of 726.09 g/mol. Its IUPAC name is 3-[[acetyl(butanoyl)amino]methyl]-5-(butanoylamino)-2,4,6-triiodobenzoic acid.
| Compound Name | 3-[[acetyl(butanoyl)amino]methyl]-5-(butanoylamino)-2,4,6-triiodobenzoic acid |
|---|---|
| PubChem CID | 172743154 |
| Molecular Formula | C18H21I3N2O5 |
| Molecular Weight | 726.09 g/mol |
| Exact Mass | 725.86 |
| IUPAC Name | 3-[[acetyl(butanoyl)amino]methyl]-5-(butanoylamino)-2,4,6-triiodobenzoic acid |
| SMILES | CCCC(=O)Nc1c(I)c(CN(C(C)=O)C(=O)CCC)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C18H21I3N2O5/c1-4-6-11(25)22-17-15(20)10(14(19)13(16(17)21)18(27)28)8-23(9(3)24)12(26)7-5-2/h4-8H2,1-3H3,(H,22,25)(H,27,28) |
| InChIKey | JJCPODQQZWVYTF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.09 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|