C22H10Cl4I6N2O6 — CID 151786236
5-[[6-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-6-oxohexanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride (PubChem CID 151786236) has the molecular formula C22H10Cl4I6N2O6 and a molecular weight of 1301.57 g/mol. Its IUPAC name is 5-[[6-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-6-oxohexanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride.
| Compound Name | 5-[[6-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-6-oxohexanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 151786236 |
| Molecular Formula | C22H10Cl4I6N2O6 |
| Molecular Weight | 1301.57 g/mol |
| Exact Mass | 1299.36 |
| IUPAC Name | 5-[[6-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-6-oxohexanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride |
| SMILES | O=C(CCCCC(=O)Nc1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I)Nc1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C22H10Cl4I6N2O6/c23-19(37)7-11(27)8(20(24)38)14(30)17(13(7)29)33-5(35)3-1-2-4-6(36)34-18-15(31)9(21(25)39)12(28)10(16(18)32)22(26)40/h1-4H2,(H,33,35)(H,34,36) |
| InChIKey | RVQWKSZZWPFNAD-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1301.57 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|