C13H8Cl2I3NO5 — CID 88753858
[2-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-2-oxoethyl] propanoate (PubChem CID 88753858) has the molecular formula C13H8Cl2I3NO5 and a molecular weight of 709.83 g/mol. Its IUPAC name is [2-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-2-oxoethyl] propanoate.
| Compound Name | [2-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 88753858 |
| Molecular Formula | C13H8Cl2I3NO5 |
| Molecular Weight | 709.83 g/mol |
| Exact Mass | 708.69 |
| IUPAC Name | [2-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)Nc1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C13H8Cl2I3NO5/c1-2-5(21)24-3-4(20)19-11-9(17)6(12(14)22)8(16)7(10(11)18)13(15)23/h2-3H2,1H3,(H,19,20) |
| InChIKey | LBJFPMPSYBLNHA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|