C11H6Cl2I3NO3 — CID 58140419
2,4,6-triiodo-5-(propanoylamino)benzene-1,3-dicarbonyl chloride (PubChem CID 58140419) has the molecular formula C11H6Cl2I3NO3 and a molecular weight of 651.79 g/mol. Its IUPAC name is 2,4,6-triiodo-5-(propanoylamino)benzene-1,3-dicarbonyl chloride.
| Compound Name | 2,4,6-triiodo-5-(propanoylamino)benzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 58140419 |
| Molecular Formula | C11H6Cl2I3NO3 |
| Molecular Weight | 651.79 g/mol |
| Exact Mass | 650.69 |
| IUPAC Name | 2,4,6-triiodo-5-(propanoylamino)benzene-1,3-dicarbonyl chloride |
| SMILES | CCC(=O)Nc1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C11H6Cl2I3NO3/c1-2-3(18)17-9-7(15)4(10(12)19)6(14)5(8(9)16)11(13)20/h2H2,1H3,(H,17,18) |
| InChIKey | RHRLTBRDTZMGHF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|