C26H10Cl4I6N2O7 — CID 150827966
5-[[3-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-3-oxo-2-phenylmethoxypropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride (PubChem CID 150827966) has the molecular formula C26H10Cl4I6N2O7 and a molecular weight of 1365.61 g/mol. Its IUPAC name is 5-[[3-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-3-oxo-2-phenylmethoxypropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride.
| Compound Name | 5-[[3-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-3-oxo-2-phenylmethoxypropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 150827966 |
| Molecular Formula | C26H10Cl4I6N2O7 |
| Molecular Weight | 1365.61 g/mol |
| Exact Mass | 1363.35 |
| IUPAC Name | 5-[[3-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-3-oxo-2-phenylmethoxypropanoyl]amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride |
| SMILES | O=C(Cl)c1c(I)c(NC(=O)C(OCc2ccccc2)C(=O)Nc2c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c2I)c(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C26H10Cl4I6N2O7/c27-21(39)8-12(31)9(22(28)40)15(34)18(14(8)33)37-25(43)20(45-6-7-4-2-1-3-5-7)26(44)38-19-16(35)10(23(29)41)13(32)11(17(19)36)24(30)42/h1-5,20H,6H2,(H,37,43)(H,38,44) |
| InChIKey | KLIHQSKYVHMUEF-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1365.61 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|