C18H16ClI3N2O7 — CID 141232571
[2-[3-carbonochloridoyl-5-[(2,2-dimethyl-1,3-dioxol-4-yl)methylcarbamoyl]-2,4,6-triiodoanilino]-2-oxoethyl] acetate (PubChem CID 141232571) has the molecular formula C18H16ClI3N2O7 and a molecular weight of 788.50 g/mol. Its IUPAC name is [2-[3-carbonochloridoyl-5-[(2,2-dimethyl-1,3-dioxol-4-yl)methylcarbamoyl]-2,4,6-triiodoanilino]-2-oxoethyl] acetate.
| Compound Name | [2-[3-carbonochloridoyl-5-[(2,2-dimethyl-1,3-dioxol-4-yl)methylcarbamoyl]-2,4,6-triiodoanilino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 141232571 |
| Molecular Formula | C18H16ClI3N2O7 |
| Molecular Weight | 788.50 g/mol |
| Exact Mass | 787.78 |
| IUPAC Name | [2-[3-carbonochloridoyl-5-[(2,2-dimethyl-1,3-dioxol-4-yl)methylcarbamoyl]-2,4,6-triiodoanilino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)Nc1c(I)c(C(=O)Cl)c(I)c(C(=O)NCC2=COC(C)(C)O2)c1I |
| InChI | InChI=1S/C18H16ClI3N2O7/c1-7(25)29-6-9(26)24-15-13(21)10(16(19)27)12(20)11(14(15)22)17(28)23-4-8-5-30-18(2,3)31-8/h5H,4,6H2,1-3H3,(H,23,28)(H,24,26) |
| InChIKey | TYZWRKXSVOWBNX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|