C17H21Cl2NO5 — CID 168948528
[2-(3,5-dicarbonochloridoyl-2,4,6-trimethylanilino)-2-oxoethyl] acetate;ethane (PubChem CID 168948528) has the molecular formula C17H21Cl2NO5 and a molecular weight of 390.26 g/mol. Its IUPAC name is [2-(3,5-dicarbonochloridoyl-2,4,6-trimethylanilino)-2-oxoethyl] acetate;ethane.
| Compound Name | [2-(3,5-dicarbonochloridoyl-2,4,6-trimethylanilino)-2-oxoethyl] acetate;ethane |
|---|---|
| PubChem CID | 168948528 |
| Molecular Formula | C17H21Cl2NO5 |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | [2-(3,5-dicarbonochloridoyl-2,4,6-trimethylanilino)-2-oxoethyl] acetate;ethane |
| SMILES | CC.CC(=O)OCC(=O)Nc1c(C)c(C(=O)Cl)c(C)c(C(=O)Cl)c1C |
| InChI | InChI=1S/C15H15Cl2NO5.C2H6/c1-6-11(14(16)21)7(2)13(8(3)12(6)15(17)22)18-10(20)5-23-9(4)19;1-2/h5H2,1-4H3,(H,18,20);1-2H3 |
| InChIKey | BJZCCDNFIIMWQQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|