C16H17Cl2NO5 — CID 143801976
[2-(3,5-dicarbonochloridoyl-N,2,4,6-tetramethylanilino)-2-oxoethyl] acetate (PubChem CID 143801976) has the molecular formula C16H17Cl2NO5 and a molecular weight of 374.22 g/mol. Its IUPAC name is [2-(3,5-dicarbonochloridoyl-N,2,4,6-tetramethylanilino)-2-oxoethyl] acetate.
| Compound Name | [2-(3,5-dicarbonochloridoyl-N,2,4,6-tetramethylanilino)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 143801976 |
| Molecular Formula | C16H17Cl2NO5 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | [2-(3,5-dicarbonochloridoyl-N,2,4,6-tetramethylanilino)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)N(C)c1c(C)c(C(=O)Cl)c(C)c(C(=O)Cl)c1C |
| InChI | InChI=1S/C16H17Cl2NO5/c1-7-12(15(17)22)8(2)14(9(3)13(7)16(18)23)19(5)11(21)6-24-10(4)20/h6H2,1-5H3 |
| InChIKey | FOTSIRIRFKLQDC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|