C13H12I3N3O5 — CID 142740080
[2-(3,5-dicarbamoyl-2,4,6-triiodo-N-methylanilino)-2-oxoethyl] acetate (PubChem CID 142740080) has the molecular formula C13H12I3N3O5 and a molecular weight of 670.97 g/mol. Its IUPAC name is [2-(3,5-dicarbamoyl-2,4,6-triiodo-N-methylanilino)-2-oxoethyl] acetate.
| Compound Name | [2-(3,5-dicarbamoyl-2,4,6-triiodo-N-methylanilino)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 142740080 |
| Molecular Formula | C13H12I3N3O5 |
| Molecular Weight | 670.97 g/mol |
| Exact Mass | 670.79 |
| IUPAC Name | [2-(3,5-dicarbamoyl-2,4,6-triiodo-N-methylanilino)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)N(C)c1c(I)c(C(N)=O)c(I)c(C(N)=O)c1I |
| InChI | InChI=1S/C13H12I3N3O5/c1-4(20)24-3-5(21)19(2)11-9(15)6(12(17)22)8(14)7(10(11)16)13(18)23/h3H2,1-2H3,(H2,17,22)(H2,18,23) |
| InChIKey | IZQBLXJOZVPYQE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.97 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|